| Identification | Back Directory | [Name]
1H-Indole-6-carboxylic acid, 4-broMo-, Methyl ester | [CAS]
882679-96-1 | [Synonyms]
Methyl 4-broMoindole-6-carboxylate Methyl 4-bromo-1h-indole-6-carboxylat Methyl 4-broMo-1H-indole-6-carboxylate 4-Bromoindole-6-Carbocylic acid methyl ester 1H-Indole-6-carboxylic acid, 4-broMo-, Methyl ester | [Molecular Formula]
C10H8BrNO2 | [MDL Number]
MFCD03867040 | [MOL File]
882679-96-1.mol | [Molecular Weight]
254.08 |
| Chemical Properties | Back Directory | [Boiling point ]
382.6±22.0 °C(Predicted) | [density ]
1.629±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,2-8°C | [pka]
14.87±0.30(Predicted) | [InChI]
InChI=1S/C10H8BrNO2/c1-14-10(13)6-4-8(11)7-2-3-12-9(7)5-6/h2-5,12H,1H3 | [InChIKey]
BHADJPVQZXGIFH-UHFFFAOYSA-N | [SMILES]
N1C2=C(C(Br)=CC(C(OC)=O)=C2)C=C1 |
|
|