| Identification | Back Directory | [Name]
[(3R)-3-aMino-4-[(3-hexylphenyl)aMino]-4-oxobutyl]-phosphonic acid | [CAS]
909725-61-7 | [Synonyms]
ML056
W146HYDRATE
R-3-amino-4-(3-hexylphenylamino)-4-oxobutylphosphonic acid hydrate
[(3R)-3-aMino-4-[(3-hexylphenyl)aMino]-4-oxobutyl]-phosphonic acid
Phosphonic acid, P-[(3R)-3-amino-4-[(3-hexylphenyl)amino]-4-oxobutyl]-
[(3R)-3-aMino-4-[(3-hexylphenyl)aMino]-4-oxobutyl]-phosphonic acid(CAS#:909725-61-7) | [Molecular Formula]
C16H27N2O4P | [MDL Number]
MFCD16875441 | [MOL File]
909725-61-7.mol | [Molecular Weight]
342.37 |
| Chemical Properties | Back Directory | [density ]
1.233±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [solubility ]
methanol: soluble (with 0.1% TFA) | [form ]
powder | [pka]
2.19±0.10(Predicted) | [color ]
off-white | [InChI]
1S/C16H27N2O4P.H2O/c1-2-3-4-5-7-13-8-6-9-14(12-13)18-16(19)15(17)10-11-23(20,21)22;/h6,8-9,12,15H,2-5,7,10-11,17H2,1H3,(H,18,19)(H2,20,21,22);1H2/t15-;/m1./s1 | [InChIKey]
DQKSZHVSROOTFY-XFULWGLBSA-N | [SMILES]
O.CCCCCCc1cccc(NC(=O)[C@H](N)CCP(O)(O)=O)c1 |
| Hazard Information | Back Directory | [Uses]
W146 is a selective antagonists of spingosine-1-phosphate receptor subtype 1. | [Definition]
ChEBI: [(3R)-3-aMino-4-[(3-hexylphenyl)aMino]-4-oxobutyl]-phosphonic acid is an amino acid amide. | [General Description]
W146 hydrate functions as an orthosteric antagonist. It is associated with blood lymphopenia and lung edema in mice. | [Biochem/physiol Actions]
Potent S1P(1) competitive antagonist; Ki = 10-77 nM. | [storage]
Store at -20°C |
|
| Company Name: |
Aemon Chemical
|
| Tel: |
0086-755-86198205 |
| Website: |
www.aemonchem.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|