| Identification | Back Directory | [Name]
Potassium (acetoxymethyl)trifluoroborate | [CAS]
910251-35-3 | [Synonyms]
acetoxymethyl(trifluoro)boranuide Potassium (acetoxymethyl)trifluoroborate | [Molecular Formula]
C3H5BF3KO2 | [MDL Number]
MFCD28023894 | [MOL File]
910251-35-3.mol | [Molecular Weight]
179.975 |
| Chemical Properties | Back Directory | [storage temp. ]
Inert atmosphere,Room Temperature | [form ]
powder to crystal | [color ]
White to Almost white | [InChI]
InChI=1S/C3H4BF3O2.K/c1-3(8)9-2-4(5,6)7;/h2H,1H3;/q-1;+1 | [InChIKey]
PBIKSAKEYWAYNX-UHFFFAOYSA-N | [SMILES]
[CH-](OC(=O)C)[B+3]([F-])([F-])[F-].[K+] |
|
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Tel: |
0573-85285100 18627885956 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList14265/0_EN.htm |
| Company Name: |
AllyChem Co., Ltd.
|
| Tel: |
0411-62313318 13942603642 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList677/0_EN.htm |
|