| Identification | Back Directory | [Name]
7-(4-Bromobenzoyl)indole | [CAS]
91714-50-0 | [Synonyms]
7-(4-Bromobenzoyl)indole Bromfenac sodium Impurity 5 | [EINECS(EC#)]
205-525-8 | [Molecular Formula]
C15H10BrNO | [MDL Number]
MFCD08694391 | [MOL File]
91714-50-0.mol | [Molecular Weight]
300.15 |
| Chemical Properties | Back Directory | [Melting point ]
162-164℃ | [Boiling point ]
468.6±20.0 °C(Predicted) | [density ]
1.530 | [pka]
15.06±0.30(Predicted) | [InChI]
InChI=1S/C15H10BrNO/c16-12-6-4-11(5-7-12)15(18)13-3-1-2-10-8-9-17-14(10)13/h1-9,17H | [InChIKey]
RNXKQFMCSXIADL-UHFFFAOYSA-N | [SMILES]
C(C1=CC=C(Br)C=C1)(C1C2=C(C=CC=1)C=CN2)=O |
|
|