| Identification | Back Directory | [Name]
(7S-cis)-9-Acetyl-9-amino-7-[(2-deoxy-alpha-D-erythro-pentopyranosyl)oxy]-7,8,9,10-tetrahydro-6,11-dihydroxy-5,12-naphthacenedione | [CAS]
92395-36-3 | [Synonyms]
Cis-Amrubicin
(2R)-Amrubicin
(+)-(7S,9S)-9-Acetyl-9-amino-7-[(2-deoxy-beta-D-erythro-pent...
(7S,9S)-9-acetyl-9-amino-7-[(2-deoxy-β-D-erythropentopyranosyl)oxy]-7,8,9,10-tetrahydro-6,11dihydroxynaphthacene-5,12-dione
(7S,9S)-9-acetyl-9-amino-7-[(2-deoxy-β-D-erythropentopyranosyl)oxy]-7,8,9,10-tetrahydro-6,11dihydroxynaphthacene-5,12-dione
(7S-cis)-9-Acetyl-9-amino-7-[(2-deoxy-alpha-D-erythro-pentopyranosyl)oxy]-7,8,9,10-tetrahydro-6,11-dihydroxy-5,12-naphthacenedione
5,12-Naphthacenedione, 9-acetyl-9-amino-7-[(2-deoxy-α-D-erythro-pentopyranosyl)oxy]-7,8,9,10-tetrahydro-6,11-dihydroxy-, (7S-cis)- (9CI) | [Molecular Formula]
C25H25NO9 | [MOL File]
92395-36-3.mol | [Molecular Weight]
483.47 |
| Chemical Properties | Back Directory | [Boiling point ]
717.8±60.0 °C(Predicted) | [density ]
1.60±0.1 g/cm3(Predicted) | [pka]
7.83±0.60(Predicted) | [InChIKey]
VJZITPJGSQKZMX-BRYWZICWNA-N | [SMILES]
O([C@@]1([H])OC[C@@H](O)[C@@H](O)C1)[C@H]1C[C@](N)(C(=O)C)CC2=C(C3C(C4=CC=CC=C4C(=O)C=3C(O)=C12)=O)O |&1:1,5,7,10,12,r| |
| Hazard Information | Back Directory | [Uses]
(R)-Amrubicin ((R)-SM-5887) is an anthracycline that effectively treats lung cancer by intercalating into DNA and inhibiting topoisomerase II activity, which consequently hampers DNA replication as well as RNA and protein synthesis, leading to cell growth inhibition and apoptosis. This compound exhibits superior anti-tumor efficacy compared to traditional anthracycline drugs while lacking the cumulative cardiac toxicity typically associated with this drug class. |
|
| Company Name: |
Abydos Scientific
|
| Tel: |
025-84767922 18936879710 |
| Website: |
http://www.abydoscientific.com/index.html |
|