| Identification | Back Directory | [Name]
3′-Phosphoadenosine-5′-phosphosulfate triethylammonium salt | [CAS]
936827-87-1 | [Synonyms]
35-PAPS-TEA
3′-Phosphoadenosine-5′-phosphosulfate triethylammonium salt
3'-Phosphoadenosine 5'-phosphosulfate triethylammnonium salt
Adenosine 3′-phosphate 5′-phosphosulfate triethylammonium salt
3'-Adenylic acid 5'-(dihydrogen phosphate) 5'-anhydride with sulfuric acid compd. with N,N-diethylethanamine (1:) | [Molecular Formula]
C16H30N6O13P2S | [MOL File]
936827-87-1.mol | [Molecular Weight]
608.45 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [solubility ]
water: soluble | [form ]
powder or crystals | [Water Solubility ]
water: soluble | [InChIKey]
IIAWHKVLRMAJSN-MCDZGGTQSA-N | [SMILES]
CCN(CC)CC.Nc1ncnc2n(cnc12)[C@@H]3O[C@H](COP(O)(=O)OS(O)(=O)=O)[C@@H](OP(O)(O)=O)[C@H]3O |
| Hazard Information | Back Directory | [Uses]
Adenosine 3μ-phosphate 5μ-phosphosulfate triethylammonium salt has been used in the determination of human 3-O-sulfotransferase-1 (3-OST-1) and aryl-sulfotransferase (AST-IV) enzyme activity. | [Biological Activity]
3μ-Phosphoadenosine-5μ-phosphosulfate (PAPS) acts as a sulfate donor and serves as a substrate for sulfotransferases (STs). |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1701258/0_EN.htm |
| Company Name: |
Hubei Baidu Chemical Co., Ltd
|
| Tel: |
027-027-59106051 13627137652 |
| Website: |
www.chemicalbook.com/showsupplierproductslist329110/0_en.htm |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|