| Identification | Back Directory | [Name]
2-HYDROXYPROPYL 2-(4-ISOBUTYLPHENYL)PROPANOATE | [CAS]
95093-58-6 | [Synonyms]
2-Hydroxypropyl 2-(4-Isobutylphenyl 2-HYDROXYPROPYL 2-(4-ISOBUTYLPHENYL)PROPANOATE (S)-(+)-Ibuprofen Propylene Glycol EsterQ: What is
(S)-(+)-Ibuprofen Propylene Glycol Ester Q: What is the CAS Number of
(S)-(+)-Ibuprofen Propylene Glycol Ester Q: What is the storage condition of
(S)-(+)-Ibuprofen Propylene Glycol Ester | [Molecular Formula]
C16H24O3 | [MOL File]
95093-58-6.mol | [Molecular Weight]
264.36 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C | [solubility ]
Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | [form ]
Oil | [color ]
Colourless | [Major Application]
pharmaceutical | [InChIKey]
VUCGZWWOXKSFFZ-UHFFFAOYSA-N | [SMILES]
O(CC(O)C)C(=O)C(C)c1ccc(cc1)CC(C)C |
| Hazard Information | Back Directory | [Uses]
2-Hydroxypropyl 2-(4-isobutylphenyl)propanoate is a derivative of Ibuprofen(I140000) a A selective cyclooxygenase inhibitor. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|