ChemicalBook >> CAS DataBase List >>2,6-Dichlorobenzene-1-sulfonyl fluoride 95%
2,6-Dichlorobenzene-1-sulfonyl fluoride 95%
- CAS No.
- 1355090-09-3
- Chemical Name:
- 2,6-Dichlorobenzene-1-sulfonyl fluoride 95%
- Synonyms
- Benzenesulfonyl fluoride, 2,6-dichloro-;2,6-Dichlorobenzene-1-sulfonyl fluoride;2,6-Dichlorobenzene-1-sulfonyl fluoride 95%
- CBNumber:
- CB28323503
- Molecular Formula:
- C6H3Cl2FO2S
- Molecular Weight:
- 229.06
- MDL Number:
- MFCD22192522
- MOL File:
- 1355090-09-3.mol
Last updated:2026-05-28 00:49:23
| Melting point | 65-70 °C |
|---|---|
| Boiling point | 282.7±30.0 °C(Predicted) |
| Density | 1.590±0.06 g/cm3(Predicted) |
| form | solid |
| InChI | 1S/C6H3Cl2FO2S/c7-4-2-1-3-5(8)6(4)12(9,10)11/h1-3H |
| InChIKey | YZHIFNHRRUIOAY-UHFFFAOYSA-N |
| SMILES | O=S(C1=C(Cl)C=CC=C1Cl)(F)=O |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
SAFETY
Risk and Safety Statements
| Symbol(GHS) |  GHS05 |
|---|---|
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
2,6-Dichlorobenzene-1-sulfonyl fluoride 95% price
| Manufacturer | Product number | Product description | CAS number | Packaging | Price | Updated | Buy |
|---|---|---|---|---|---|---|---|
| aablocks | AA01AMJI | 2,6-dichlorobenzene-1-sulfonyl fluoride 95% | 1355090-09-3 | 100mg | $130 | 2026-05-29 | Buy |
| aablocks | AA01AMJI | 2,6-dichlorobenzene-1-sulfonyl fluoride 95% | 1355090-09-3 | 250mg | $132 | 2026-05-29 | Buy |
| aablocks | AA01AMJI | 2,6-dichlorobenzene-1-sulfonyl fluoride 95% | 1355090-09-3 | 500mg | $133 | 2026-05-29 | Buy |
| aablocks | AA01AMJI | 2,6-dichlorobenzene-1-sulfonyl fluoride 95% | 1355090-09-3 | 1g | $135 | 2026-05-29 | Buy |
| aablocks | AA01AMJI | 2,6-dichlorobenzene-1-sulfonyl fluoride 95% | 1355090-09-3 | 2.5g | $169 | 2026-05-29 | Buy |
2,6-Dichlorobenzene-1-sulfonyl fluoride 95% Chemical Properties, Uses, Production
Uses
Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers.
reaction suitability
reaction type: click chemistry
2,6-Dichlorobenzene-1-sulfonyl fluoride 95% Preparation Products And Raw materials
Raw materials
Preparation Products
2,6-Dichlorobenzene-1-sulfonyl fluoride 95% Suppliers
Global Suppliers ( 4)
| Supplier | Tel | Country | ProdList | Advantage | |
|---|---|---|---|---|---|
| Sigma-Aldrich | 021-61415566 800-8193336 | orderCN@merckgroup.com | China | 51389 | 80 |
| Energy Chemical | 400-0056266 | marketing1@energy-chemical.com | China | 44927 | 58 |
| Hangzhou Taorui Biotechnology Co., Ltd | QQ1259737804 15268198094 | sales@torreybio.com | China | 4129 | 58 |
| Supplier | Advantage |
|---|---|
| Sigma-Aldrich | 80 |
| Energy Chemical | 58 |
| Hangzhou Taorui Biotechnology Co., Ltd | 58 |
2,6-Dichlorobenzene-1-sulfonyl fluoride 95%
2,6-Dichlorobenzene-1-sulfonyl fluoride
Benzenesulfonyl fluoride, 2,6-dichloro-
1355090-09-3
