| | 105362-40-1 Basic information More.. |
| Product Name: | Ethanol, 2,2,2-nitrilotris-, compd. with .alpha.-2,4,6-tris(1-phenylethyl)phenyl-.omega.-hydroxypoly(oxy-1,2-ethanediyl) phosphate | | Synonyms: | Ethanol, 2,2,2-nitrilotris-, compd. with .alpha.-2,4,6-tris(1-phenylethyl)phenyl-.omega.-hydroxypoly(oxy-1,2-ethanediyl) phosphate;Ethanol, 2,2′,2′′-nitrilotris-, compd. with alpha-(2,4,6-tris(1-phenylethyl)-omega-hydroxypoly(oxy-1,2-ethanediyl)phosphate, ca. 20 EO;HOE 3475;HOE-S 3475;Soprophor FL;Soprophor FL 60;Ethanol, 2,2,2-nitrilotris-, compd. with .alpha.-2,4,6-tris(1-phenylethyl)phenyl-.omega.-hydroxypoly;Ethanol, 2,2,2-nitrilotris-, compd. with α-(2,4,6-tris(1-phenylethyl)phenyl)-omega-hydroxypoly(oxy-1,2-ethanediyl) phosphate | | CAS: | 105362-40-1 | | MF: | C6H15NO3.x(C2H4O)nC30H30O.xH3O4P | | MW: | 0 | | EINECS: | | | Mol File: | Mol File |  |
|
|
105362-40-1 Recommend
Suppliers |
|
|
Recommend You Select Member Companies. |
|
1
|