| | Fmoc-NH-(PEG)1-CH2CH2COOH - 1 g Basic information More.. |
| Product Name: | Fmoc-NH-(PEG)1-CH2CH2COOH - 1 g | | Synonyms: | Fmoc-NH-(PEG)1-CH2CH2COOH - 1 g | | CAS: | | | MF: | | | MW: | 0 | | EINECS: | | | Mol File: | Mol File |  |
|
| Browse by Nationality
Fmoc-NH-(PEG)1-CH2CH2COOH - 1 g
Suppliers |
China suppliers |
|
Fmoc-NH-(PEG)1-CH2CH2COOH - 1 g Recommend
Suppliers |
|
|
Recommend You Select Member Companies. |
|
1
|