| Company Name: |
LUPIN LTD
|
| Tel: |
+91 124 4885000 / +91 124 3325000 |
| Email: |
info@lupin.com |
| Products Intro: |
Cas:1369773-39-6
ProductName:SACUBITRIL CALCIUM
|
| Company Name: |
Guangzhou Younan Technology Co., Ltd
|
| Tel: |
020-82000279 18988941452 |
| Email: |
YN_research@163.com |
| Products Intro: |
Cas:1369773-39-6
ProductName:Sacubitril calcium
Purity: 95+/98+ | Package: 25mg;100mg;500mg;1g;5g
|
| Company Name: |
Hangzhou Yiyun Guoke Biotechnology Co., Ltd.
|
| Tel: |
18457506494 |
| Email: |
1211221625@qq.com |
| Products Intro: |
Cas:1369773-39-6
ProductName:Sacubitril Calcium salt
Purity: 99% HPLC | Package: 10mg;20mg;25mg;50mg;100mg
|
- Sacubitril
-
- $57.00
-
2026-07-27
- CAS:149709-62-6
- Purity: 98.28%
- Supply Ability: 10g
- Sacubitril Sodium
-
- $1.10
-
2026-06-02
- CAS:149690-05-1
- Min. Order: 1g
- Purity: 99.9%
- Supply Ability: 100 Tons Min
- sacubitril
-
- $1.10
-
2025-11-18
- CAS:1038924-61-6
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | Sacubitril Calcium Basic information |
| Product Name: | Sacubitril Calcium | | Synonyms: | AHU-377 (heMicalciuM salt);(alphaR,gammaS)-gamma-[(3-Carboxy-1-oxopropyl)amino]-alpha-methyl-[1,1'-biphenyl]-4-pentanoic acid 4-ethyl ester calcium salt (2:1);(2S,4R)-5-(Biphenyl-4-yl)-4-[(3-carboxypropionyl)amino]-2-methylpentanoic acid ethyl ester,calcium salt(2:1);AHU-377 hemicalcium salt (2:1);Calciumbis(4-{[(1S,3R)-1-([1,1'-biphenyl]-4-ylmethyl)-4-ethoxy-3-methyl-4-oxobutyl] amino} -4-oxobutanoate);LCZ696(valsartan + sacubitril) impurity 1;Ethyl (αR,γS)-γ-[(3-carboxy-1-oxopropyl)amino]-α-methyl-[1,1'-biphenyl]-4-pentanoate hemicalcium salt;(alphar | | CAS: | 1369773-39-6 | | MF: | C48H56CaN2O10 | | MW: | 861.04364 | | EINECS: | 935-847-3 | | Product Categories: | Intermediates;LCZ 696;Pharmaceutical Intermediates;lcz696;1369773-39-6 | | Mol File: | 1369773-39-6.mol |  |
| | Sacubitril Calcium Chemical Properties |
| Melting point | >140°C (dec.) | | density | 1.24g/cm3 at 20℃ | | vapor pressure | 0.001Pa at 20℃ | | storage temp. | -20°C | | solubility | DMSO (Slightly, Heated), Methanol (Slightly) | | form | powder | | color | white to beige | | Optical Rotation | -16.3°(C=0.01g/mL,MEOH, 20°C, 589nm) | | InChIKey | DDLCKLBRBPYKQS-AGIGYYLVNA-L | | SMILES | [Ca+2].N([C@@H](C[C@@H](C)C(=O)OCC)Cc3ccc(cc3)c4ccccc4)C(=O)CCC(=O)[O-].N([C@@H](C[C@@H](C)C(=O)OCC)Cc1ccc(cc1)c2ccccc2)C(=O)CCC(=O)[O-] | | LogP | -0.66-2.9 at 20℃ and pH2-7 |
| RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Acute 1 |
| | Sacubitril Calcium Usage And Synthesis |
| Description | Sacubitril calcium is a membrane metallo-endopeptidase (neprilysin) inhibitor prodrug. Increases ANF-induced natriuresis without affecting diuresis in rats.
|
| | Sacubitril Calcium Preparation Products And Raw materials |
|