- 4-Chlorophenethylamine
-
- $1.10 / 1g
-
2025-11-18
- CAS:156-41-2
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
- 4-Chlorophenethylamine
-
- $5.00 / 1KG
-
2025-05-26
- CAS:156-41-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | 4-Chlorophenethylamine Basic information |
| | 4-Chlorophenethylamine Chemical Properties |
| Boiling point | 60-65 °C0.1 mm Hg(lit.) | | density | 1.112 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.548(lit.) | | Fp | 223 °F | | storage temp. | Store Cold | | pka | 9.72±0.10(Predicted) | | form | Liquid | | color | Clear colorless to yellow | | Specific Gravity | 1.12 | | BRN | 508247 | | InChI | InChI=1S/C8H10ClN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5-6,10H2 | | InChIKey | SRXFXCKTIGELTI-UHFFFAOYSA-N | | SMILES | C1(CCN)=CC=C(Cl)C=C1 | | CAS DataBase Reference | 156-41-2(CAS DataBase Reference) |
| Hazard Codes | Xi,C,T | | Risk Statements | 36/37/38-34 | | Safety Statements | 26-36-45-36/37/39 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | IRRITANT | | HS Code | 29214990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Chlorophenethylamine Usage And Synthesis |
| Chemical Properties | Dark Solid | | Uses | 2-(4-Chlorophenyl)ethylamine has been used as a reactant in the preparation of isoalloxazine derivatives as cholinesterase inhibitors with a potential use in Alzheimer therapy. |
| | 4-Chlorophenethylamine Preparation Products And Raw materials |
|