| Company Name: |
Capot Chemical Co.,Ltd. |
| Tel: |
+86-（0）57185586718; +8613336195806 |
| Email: |
sales@capot.com |
| Products Intro: |
Product Name:2-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:458532-84-8
Purity:98%(Min,HPLC) Package:100g;1kg;5kg,10kg,25kg,50kg
|
|
|
|
|
|
| | 2-Chloropyridine-4-boronic acid pinacol ester Basic information |
| Product Name: | 2-Chloropyridine-4-boronic acid pinacol ester | | Synonyms: | 2-CHLORO-4-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PYRIDINE;2-CHLOROPYRIDINE-4-BORONIC ACID, PINACOL ESTER;2-CHLOROPYRIDINE-4-BORONIC PINACOL ESTER;2-CHLORO-4-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABROLAN-2-YL)-PYRIDINE;2-CHLOROPYRIDIN-4-YLBORONIC ACID PINACOL ESTER;2-[4-(2-chloro)pyridine]-4,4,5,5-tetraMethyl-1,3-dioxaborolane;2-Chloro-4-(4;2-chloro-4-(tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine | | CAS: | 458532-84-8 | | MF: | C11H15BClNO2 | | MW: | 239.51 | | EINECS: | | | Product Categories: | pharmacetical;Heterocyclic Compounds | | Mol File: | 458532-84-8.mol |  |
| | 2-Chloropyridine-4-boronic acid pinacol ester Chemical Properties |
| Melting point | 64.7-64.8°C | | Boiling point | 338.2±27.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | -0.58±0.10(Predicted) | | color | White to Light yellow to Light orange | | InChI | 1S/C11H15BClNO2/c1-10(2)11(3,4)16-12(15-10)8-5-6-14-9(13)7-8/h5-7H,1-4H3 | | InChIKey | UUEQDBHKMOFLDP-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2ccnc(Cl)c2 | | CAS DataBase Reference | 458532-84-8(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 25-36 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2 |
| Provider | Language |
|
ALFA
| English |
| | 2-Chloropyridine-4-boronic acid pinacol ester Usage And Synthesis |
| Uses | 2-Chloropyridine-4-boronic acid pinacol ester is a pharmaceutical intermediate ingredient used in the preparation of anti-tumour inhibitor pyrimidine compounds, mainly in organic reagents and experimental research. |
| | 2-Chloropyridine-4-boronic acid pinacol ester Preparation Products And Raw materials |
|