|
|
| | GAMMA-LUMICOLCHICINE Basic information |
| Product Name: | GAMMA-LUMICOLCHICINE | | Synonyms: | GAMMA-LUMICOLCHICINE;[7S-(7alpha,7balpha,10aalpha)]-N-(5,6,7,7b,8,10a-hexahydro-1,2,3,9-tetramethoxy-8-oxobenzo[a]cyclopenta[3,4]cyclobuta[1,2-c]cyclohepten-7-yl)acetamide;g-Lumicolchicine;(7S-(7alpha,7Balpha,10aalpha))-N-(5,6,7,7B,8,10A-hexahydro-1,2,3,9-tetramethoxy-8-oxobenzo(A)cyclopenta(3,4)cyclobuta(1,2-C)cyclohepten-7-yl)acetamide;Einecs 230-009-7;N-[(7S,7bS,10aR)-5,6,7,7b,8,10a-Hexahydro-1,2,3,9-tetramethoxy-8-oxobenzo[a]cyclopenta[3,4]cyclobuta[1,2-c]cyclohepten-7-yl]acetamide;Colchicine impurity G;Colchicine Impurity 7(Colchicine EP Impurity G) | | CAS: | 6901-14-0 | | MF: | C22H25NO6 | | MW: | 399.44 | | EINECS: | 230-009-7 | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 6901-14-0.mol |  |
| | GAMMA-LUMICOLCHICINE Chemical Properties |
| Melting point | 268°C | | Boiling point | 623.2±55.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | pka | 0.10±0.40(Predicted) | | form | Solid | | color | White | | InChIKey | VKPVZFOUXUQJMW-LXIYXOSZSA-N | | SMILES | C(N[C@H]1CCC2=CC(OC)=C(OC)C(OC)=C2C2[C@]3([H])C=C(OC)C(=O)[C@]3([H])C=21)(=O)C | | CAS DataBase Reference | 6901-14-0 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 |
| | GAMMA-LUMICOLCHICINE Usage And Synthesis |
| Uses | γ-Lumi (-)-Colchicine is a component of Colchicum species of plants and an electrocyclization product of Colchicine (C640000), an antimitotic agent that disrupts microtubules polymerization. |
| | GAMMA-LUMICOLCHICINE Preparation Products And Raw materials |
| Raw materials | [7S-(7alpha,7bbeta,10abeta)]-N-(5,6,7,7b,8,10a-hexahydro-1,2,3,9-tetramethoxy-8-oxobenzo[a]cyclopenta[3,4]cyclobuta[1,2-c]cyclohepten-7-yl)acetamide-->Colchicine | | Preparation Products | Acetamide, N,N'-[(7S,7bR,8aS,8bS,9aR,10S,16cS,16dR,16eR,16fS)-5,6,7,7b,8,8a,8b,9,9a,10,11,12,16c,16d,16e,16f-hexadecahydro-1,2,3,8a,8b,14,15,16-octamethoxy-8,9-dioxobisbenzo[3',4']cyclohepta[1',2':3,4]cyclobuta[1,2-c:1',2'-c']cyclobuta[1,2-a:4,3-a']dicyclopentene-7,10-diyl]bis- |
|