|
|
| | 2-(3-Iodopropyl)-1H-isoindole-1,3(2H)-dione Basic information |
| Product Name: | 2-(3-Iodopropyl)-1H-isoindole-1,3(2H)-dione | | Synonyms: | 2-(3-Iodopropyl)-1H-isoindole-1,3(2H)-dione;Nsc24938;1H-Isoindole-1,3(2H)-dione,2-(3-iodopropyl)-;N-(3-Iodopropyl)phthaliMide;2-(3-iodopropyl)isoindole-1,3-dione;SKL581;2-(3-Iodopropyl)isoindoline-1,3-dione;Melatonin impurity 33 | | CAS: | 5457-29-4 | | MF: | C11H10INO2 | | MW: | 315.11 | | EINECS: | | | Product Categories: | | | Mol File: | 5457-29-4.mol |  |
| | 2-(3-Iodopropyl)-1H-isoindole-1,3(2H)-dione Chemical Properties |
| Melting point | 84-86 °C | | Boiling point | 373.3±25.0 °C(Predicted) | | density | 1.795±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | -2.19±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H10INO2/c12-6-3-7-13-10(14)8-4-1-2-5-9(8)11(13)15/h1-2,4-5H,3,6-7H2 | | InChIKey | LKSISOJOXOBDGH-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1CCCI |
| | 2-(3-Iodopropyl)-1H-isoindole-1,3(2H)-dione Usage And Synthesis |
| | 2-(3-Iodopropyl)-1H-isoindole-1,3(2H)-dione Preparation Products And Raw materials |
|