4-ACETYLPHENYL ETHER manufacturers
|
| | 4-ACETYLPHENYL ETHER Basic information |
| Product Name: | 4-ACETYLPHENYL ETHER | | Synonyms: | 1,1’-(oxydi-4,1-phenylene)bis-ethanon;1,1’-(oxydi-4,1-phenylene)bisethanone;4,4’-diacetyldiphenyloxide;4,4’-oxybis(acetetophenone);4,4’-oxydiacetophenone;4’,4’’’-oxydi-acetophenon;4’,4’’’-oxydiacetophenone;bis(4-acetylphenyl)ether | | CAS: | 2615-11-4 | | MF: | C16H14O3 | | MW: | 254.28 | | EINECS: | | | Product Categories: | Aromatic Ethers | | Mol File: | 2615-11-4.mol |  |
| | 4-ACETYLPHENYL ETHER Chemical Properties |
| Melting point | 103-105°C | | Boiling point | 200°C 1mm | | density | 1.139±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | form | solid | | InChI | 1S/C16H14O3/c1-11(17)13-3-7-15(8-4-13)19-16-9-5-14(6-10-16)12(2)18/h3-10H,1-2H3 | | InChIKey | GZRGHDIUPMPHCB-UHFFFAOYSA-N | | SMILES | O=C(C)C(C=C1)=CC=C1OC2=CC=C(C=C2)C(C)=O | | CAS DataBase Reference | 2615-11-4(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HS Code | 2909199090 | | Storage Class | 11 - Combustible Solids |
| | 4-ACETYLPHENYL ETHER Usage And Synthesis |
| | 4-ACETYLPHENYL ETHER Preparation Products And Raw materials |
|