| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
821-50328103-801 18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:(+)-B-HYDRASTINE HCL
CAS:5936-28-7
Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
| Company Name: |
Shaanxi Dideu Newmaterial Co., Ltd.
|
| Tel: |
029-029-63373950 17392216152 |
| Email: |
1050@dideu.com |
| Products Intro: |
Product Name:Hydrastine hydrochloride
CAS:5936-28-7
Purity:99% Package:25kg
|
|
| | (+)-B-HYDRASTINE HCL Basic information |
| Product Name: | (+)-B-HYDRASTINE HCL | | Synonyms: | (+)-B-HYDRASTINE HCL;(+)-BETA-HYDRASTINE HCL;ISOCORYNE HYDROCHLORIDE;HYDRASTINE HCL, (+)-B-;HYDRASTINE HYDROCHLORIDE;Hydrastinine (base and/or unspecified salts);(1R,9S)-(+)-β-Hydrastine hydrochloride;HYDRASTINE HCl, (+)-B-(P) | | CAS: | 5936-28-7 | | MF: | C21H22ClNO6 | | MW: | 419.86 | | EINECS: | 227-692-9 | | Product Categories: | Alkaloids | | Mol File: | 5936-28-7.mol |  |
| | (+)-B-HYDRASTINE HCL Chemical Properties |
| Melting point | 115°C | | alpha | D17 +127° (c = 4 in dil HCl) | | storage temp. | −20°C | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C21H21NO6.ClH/c1-22-7-6-11-8-15-16(27-10-26-15)9-13(11)18(22)19-12-4-5-14(24-2)20(25-3)17(12)21(23)28-19;/h4-5,8-9,18-19H,6-7,10H2,1-3H3;1H/t18-,19+;/m1./s1 | | InChIKey | URBFHJWLYXILMP-VOMIJIAVSA-N | | SMILES | Cl.COc1ccc2[C@H](OC(=O)c2c1OC)[C@@H]3N(C)CCc4cc5OCOc5cc34 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | RIDADR | 1544 | | WGK Germany | WGK 3 | | RTECS | MU6125000 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | (+)-B-HYDRASTINE HCL Usage And Synthesis |
| Uses | Hydrastine hydrochloride EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. | | Biological Activity | Tyrosine hydroxylase inhibitor. Reduces dopamine content in PC12 cells. |
| | (+)-B-HYDRASTINE HCL Preparation Products And Raw materials |
|