- N-(tert-Butyl)benzylamine
-
- $15.00 / 1KG
-
2021-08-11
- CAS:3378-72-1
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| Product Name: | N-(tert-Butyl)benzylamine | | Synonyms: | TERT-BUTYL-BENZYLAMINE;AKOS BC-1243;N-TERT-BUTYLBENZYLAMINE;N-BENZYL-T-BUTYLAMINE;N-BENZYL-TERT-BUTYLAMINE;benzyl-tert-butyl-amine;N-Benzylisobutylamine;N-t-Butylbenzylamine | | CAS: | 3378-72-1 | | MF: | C11H17N | | MW: | 163.26 | | EINECS: | 222-179-6 | | Product Categories: | bc0001 | | Mol File: | 3378-72-1.mol |  |
| | N-(tert-Butyl)benzylamine Chemical Properties |
| Melting point | -25 °C | | Boiling point | 80 °C5 mm Hg(lit.) | | density | 0.881 g/mL at 25 °C(lit.) | | vapor pressure | 12.1Pa at 25℃ | | refractive index | n20/D 1.497(lit.) | | Fp | 176 °F | | storage temp. | Store below +30°C. | | solubility | 2g/l | | pka | 9.77±0.29(Predicted) | | form | Oil | | color | Colourless | | Water Solubility | 2 g/L (20 ºC) | | Sensitive | Air Sensitive | | BRN | 507464 | | Dielectric constant | 3.2400000000000002 | | InChI | 1S/C11H17N/c1-11(2,3)12-9-10-7-5-4-6-8-10/h4-8,12H,9H2,1-3H3/p+1 | | InChIKey | DLSOILHAKCBARI-UHFFFAOYSA-N | | SMILES | [N+H2](C(C)(C)C)Cc1ccccc1 | | LogP | 2.9 at 25℃ | | CAS DataBase Reference | 3378-72-1(CAS DataBase Reference) | | NIST Chemistry Reference | Benzenemethanamine, N-(1,1-dimethylethyl)-(3378-72-1) | | EPA Substance Registry System | Benzenemethanamine, N-(1,1-dimethylethyl)- (3378-72-1) |
| Hazard Codes | C,Xi | | Risk Statements | 34-22-36/37/38 | | Safety Statements | 23-24/25-36-26-45-36/37/39 | | RIDADR | 2735 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29214980 | | Storage Class | 8A - Combustible, corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Corr. 1B |
| | N-(tert-Butyl)benzylamine Usage And Synthesis |
| Preparation | N-(tert-Butyl)benzylamine can be prepared by refluxing condensation of tert-butylamine and benzyl chloride in dimethylformamide. | | Chemical Properties | CLEAR COLOURLESS TO PALE YELLOW LIQUID | | Uses | N-Benzyl-tert-butylamine, is used as a protected amine. It aids in the oxidation to the corresponding hydroxylamine and nitrone. | | Synthesis Reference(s) | Tetrahedron Letters, 36, p. 9555, 1995 DOI: 10.1016/0040-4039(95)02046-2 | | Purification Methods | Dissolve the amine in Et2O, dry it over KOH pellets, filter and fractionate it in a N2 atmosphere to avoid reaction with CO2 from the air. The hydrochloride has m 245-246o(dec) (from MeOH/Me2CO) and the perchlorate has m 200-201o. [Freidfelder et al. J Am Chem Soc 80 4320 1958, Beilstein 12 IV 2166.] |
| | N-(tert-Butyl)benzylamine Preparation Products And Raw materials |
|