| Company Name: |
Aquigen Bio science Pvt Ltd
|
| Tel: |
+91-7030123794 |
| Email: |
archana.n@aquigenbio.com |
| Products Intro: |
Product Name:Isavuconazole Impurity 53 Purity:98% Package:100mg, 500mg, and 1gm
|
| Company Name: |
ChemStrong Scientific Co.,Ltd Gold
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:Isavuconazole Impurity 20 CAS:2733698-17-2 Purity:95% HPLC Package:10mg;25mg;50mg
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Tamsulosin-d3 HCl CAS:2733698-17-2 Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
|
| | Glycine, N-methyl-, [2-[[(ethenyloxy)carbonyl]methylamino]-3-pyridinyl]methyl ester Basic information |
| Product Name: | Glycine, N-methyl-, [2-[[(ethenyloxy)carbonyl]methylamino]-3-pyridinyl]methyl ester | | Synonyms: | [2-[ethenoxycarbonyl(methyl)amino]pyridin-3-yl]methyl 2-(methylamino)acetate;Isavuconazole Impurity 53;Tamsulosin-d3 HCl;(2-(Methyl((vinyloxy)carbonyl)amino)pyridin-3-yl)methyl methylglycinate;Glycine, N-methyl-, [2-[[(ethenyloxy)carbonyl]methylamino]-3-pyridinyl]methyl ester;Isavuconazole Impurity 7 Monomer;Isavuconazole Impurity N20HCI;(2-(methyl((vinyloxy)carbonyl)amino)pyridin-3-yl)methyl methylglycinate sulfate | | CAS: | 2733698-17-2 | | MF: | C13H17N3O4 | | MW: | 279.3 | | EINECS: | | | Product Categories: | | | Mol File: | 2733698-17-2.mol | ![Glycine, N-methyl-, [2-[[(ethenyloxy)carbonyl]methylamino]-3-pyridinyl]methyl ester Structure](CAS/20211123/GIF/2733698-17-2.gif) |
| | Glycine, N-methyl-, [2-[[(ethenyloxy)carbonyl]methylamino]-3-pyridinyl]methyl ester Chemical Properties |
| Boiling point | 409.0±45.0 °C(Predicted) | | density | 1.212±0.06 g/cm3(Predicted) | | pka | 7.35±0.10(Predicted) | | InChI | InChI=1S/C13H17N3O4/c1-4-19-13(18)16(3)12-10(6-5-7-15-12)9-20-11(17)8-14-2/h4-7,14H,1,8-9H2,2-3H3 | | InChIKey | HHWWFLOAMBLMJQ-UHFFFAOYSA-N | | SMILES | N(C1N=CC=CC=1COC(=O)CNC)(C)C(=O)OC=C |
| | Glycine, N-methyl-, [2-[[(ethenyloxy)carbonyl]methylamino]-3-pyridinyl]methyl ester Usage And Synthesis |
| | Glycine, N-methyl-, [2-[[(ethenyloxy)carbonyl]methylamino]-3-pyridinyl]methyl ester Preparation Products And Raw materials |
|