- 1-Hydroxy-ibuprofen
-
- $366.00 / 10mg
-
2026-01-04
- CAS:53949-53-4
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | 1-Hydroxyibuprofen Basic information |
| Product Name: | 1-Hydroxyibuprofen | | Synonyms: | 1-Hydroxy-ibuprofen - Mixture of diastereoisomers;Ibuprofen EP Impurity;1-Hydroxy Ibuprofen (Ibuprofen Impurity L)(Mixture of Diastereomers);2-[4'-(1-Hydroxy-2-methylpropyl)phenyl]propionic Acid;4-(1-Hydroxy-2-methylpropyl)-a-methylbenzeneacetic Acid;Benzeneacetic acid, 4-(1-hydroxy-2-methylpropyl)--alpha--methyl- (9CI);4-(1-Hydroxy-2-Methylpropyl)-α-Methylbenzeneacetic Acid;Ibuprofen IMpurity-L(EP/BP) | | CAS: | 53949-53-4 | | MF: | C13H18O3 | | MW: | 222.28 | | EINECS: | | | Product Categories: | PHENYL;Aromatics;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 53949-53-4.mol |  |
| | 1-Hydroxyibuprofen Chemical Properties |
| Melting point | 80-85°C | | Boiling point | 367.5±22.0 °C(Predicted) | | density | 1.119±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Acetonitrile (Slightly), Chloroform (Slightly, Heated), Methanol (Slightly) | | pka | 4.39±0.10(Predicted) | | color | White to Off-White | | BRN | 22307543 | | Major Application | forensics and toxicology
pharmaceutical (small molecule) | | InChI | InChI=1S/C13H18O3/c1-8(2)12(14)11-6-4-10(5-7-11)9(3)13(15)16/h4-9,12,14H,1-3H3,(H,15,16) | | InChIKey | RMOQYHYFRKTDRI-UHFFFAOYSA-N | | SMILES | C1(C(C)C(O)=O)=CC=C(C(O)C(C)C)C=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-Hydroxyibuprofen Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 1-Hydroxy Ibuprofen, also known as Ibuprofen EP Impurity L, is a degradation product of Ibuprofen. Ibuprofen is a metabolite of the non-steroidal anti-inflammatory drug (NSAID) and non-selective COX inhibitor. | | Definition | ChEBI: 1-Hydroxyibuprofen is a monocarboxylic acid and a member of benzenes. |
| | 1-Hydroxyibuprofen Preparation Products And Raw materials |
|