3-METHOXYPROPIONIC ACID manufacturers
- m-PEG1-COOH
-
-
2025-06-07
- CAS:2544-06-1
- Min. Order: 500g
- Purity: >98.00%
- Supply Ability: 500g
|
| | 3-METHOXYPROPIONIC ACID Basic information |
| | 3-METHOXYPROPIONIC ACID Chemical Properties |
| Boiling point | 116 °C/9 mmHg (lit.) | | density | 1.108 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.420(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Chloroform, Methanol | | pka | 4.29±0.10(Predicted) | | form | liquid | | color | Colourless | | Specific Gravity | 1.108 | | BRN | 1743053 | | InChI | InChI=1S/C4H8O3/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6) | | InChIKey | YSIKHBWUBSFBRZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2918999090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-METHOXYPROPIONIC ACID Usage And Synthesis |
| Description | m-PEG1-acid is a PEG linker containing a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media. | | General Description | 3-Methoxypropionic acid is an alkoxy acid. The base-catalyzed methanolysis of 1-nitroso-5,6-dihydrouracil, potent liver carcinogen, is reported to yield 3-methoxypropionic acid. |
| | 3-METHOXYPROPIONIC ACID Preparation Products And Raw materials |
|