|
|
| | 5-Bromo-3-Methoxy-Pyridine2-Carbonitrile Basic information |
| | 5-Bromo-3-Methoxy-Pyridine2-Carbonitrile Chemical Properties |
| Boiling point | 310.9±37.0 °C(Predicted) | | density | 1.65±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -7.15±0.10(Predicted) | | form | solid | | Appearance | White to yellow Solid | | InChI | InChI=1S/C7H5BrN2O/c1-11-7-2-5(8)4-10-6(7)3-9/h2,4H,1H3 | | InChIKey | WIRVBLLSXJUOHZ-UHFFFAOYSA-N | | SMILES | C1(C#N)=NC=C(Br)C=C1OC |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT |
| | 5-Bromo-3-Methoxy-Pyridine2-Carbonitrile Usage And Synthesis |
| Synthesis | Sodium methanolate (2.68 g, 49.59 mmol) was added to a solution of 5-bromo-3-fluoropyridine-2-carbonitrile (2.00 g, 9.93 mmol) in tetrahydrofuran (THF, 80 mL) at room temperature. The reaction mixture was stirred at 70 °C for 3 hours. Upon completion of the reaction, the pH of the reaction mixture was adjusted to 7 with a 3 M solution of HCl. The reaction mixture was extracted with ethyl acetate (100 mL x 3). The organic phases were combined, washed with brine and dried over anhydrous sodium sulfate. The solvent was removed by concentration under reduced pressure to give 5-bromo-3-methoxypyridine-2-carbonitrile as a brown solid (2.00 g, 95% yield). Mass spectrum (MS): m/z = 213.0 [M + H]+. | | References | [1] Patent: US2016/376283, 2016, A1. Location in patent: Paragraph 1219; 1220
[2] Patent: EP3275864, 2018, A1. Location in patent: Paragraph 0032; 0038; 0044; 0050; 0056; 0062
[3] Patent: WO2007/87488, 2007, A2. Location in patent: Page/Page column 24 |
| | 5-Bromo-3-Methoxy-Pyridine2-Carbonitrile Preparation Products And Raw materials |
|