- 4-Chloro-alpha-methylstyrene
-
- $15.00 / 1KG
-
2021-08-11
- CAS:1712-70-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 4-Chloro-alpha-methylstyrene Basic information |
| | 4-Chloro-alpha-methylstyrene Chemical Properties |
| Boiling point | 205-207 °C | | density | 1.065 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.555(lit.) | | Fp | 165 °F | | storage temp. | Store below +30°C. | | form | liquid | | Specific Gravity | 1.065 | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Soluble in water. | | BRN | 1855073 | | InChI | InChI=1S/C9H9Cl/c1-7(2)8-3-5-9(10)6-4-8/h3-6H,1H2,2H3 | | InChIKey | WQDGTJOEMPEHHL-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(C(C)=C)C=C1 | | CAS DataBase Reference | 1712-70-5(CAS DataBase Reference) | | NIST Chemistry Reference | 4-ClC6H4C(CH3)=CH2(1712-70-5) |
| Safety Statements | 23-24/25 | | RIDADR | 3082 | | WGK Germany | 3 | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29036990 |
| | 4-Chloro-alpha-methylstyrene Usage And Synthesis |
| Chemical Properties | clear colorless to pale yellow liquid |
| | 4-Chloro-alpha-methylstyrene Preparation Products And Raw materials |
| Raw materials | Tetrahydrofuran-->Isopropyl alcohol-->Iodomethane-->Potassium bisulfate-->p-Dichlorobenzene-->Benzene, 1-chloro-4-(1E)-1-propen-1-yl--->Methyltriphenylphosphonium iodide-->1-Chloro-4-iodobenzene-->METHYLTRIPHENYLPHOSPHONIUM IODIDE-->4'-Chloroacetophenone-->p-chloro-alpha,alpha-dimethylbenzyl alcohol-->4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)CHLOROBENZENE | | Preparation Products | 4-(4-CHLOROPHENYL)-1,2,3,6-TETRAHYDROPYRIDINE HYDROCHLORIDE-->4-bromo-4-(4-chlorophenyl)piperidinium bromide |
|