2-Propenamide, N-[2-(3,4-dihydroxyphenyl)ethyl]- (9CI) manufacturers
|
| | 2-Propenamide, N-[2-(3,4-dihydroxyphenyl)ethyl]- (9CI) Basic information |
| | 2-Propenamide, N-[2-(3,4-dihydroxyphenyl)ethyl]- (9CI) Chemical Properties |
| Boiling point | 496℃ | | density | 1.221 | | Fp | 254℃ | | pka | 9.78±0.10(Predicted) | | form | Solid | | color | Off-white to light yellow | | InChI | InChI=1S/C11H13NO3/c1-2-11(15)12-6-5-8-3-4-9(13)10(14)7-8/h2-4,7,13-14H,1,5-6H2,(H,12,15) | | InChIKey | XNBSIDRUUSNPGM-UHFFFAOYSA-N | | SMILES | C(NCCC1=CC=C(O)C(O)=C1)(=O)C=C |
| | 2-Propenamide, N-[2-(3,4-dihydroxyphenyl)ethyl]- (9CI) Usage And Synthesis |
| Uses | Dopamine acrylamide, a polyphenol derivative, can cross-link collagen mainly via noncovalent bonding under acidic-non-oxidized conditions[1]. | | References | [1] Leping Wu, et al. Mechanism and Effects of Polyphenol Derivatives for Modifying Collagen. ACS Biomater Sci Eng. 2019 Sep 9;5(9):4272-4284. DOI:10.1021/acsbiomaterials.9b00593 |
| | 2-Propenamide, N-[2-(3,4-dihydroxyphenyl)ethyl]- (9CI) Preparation Products And Raw materials |
|