|
|
| | benzofuran-6-carboxylic acid Basic information | | Uses |
| Product Name: | benzofuran-6-carboxylic acid | | Synonyms: | Lifitegrast Intermediate 1;Benzofuran-6-Caboxylic Acid;benzofuran-6-carboxylic acid;6-Benzofurancarboxylic acid;1-benzofuran-6-carboxylic acid;Lifitegrast Impurity 29;6-Benzofurancarboxylic acid / Lifitegrast intermediate;1-Piperazinecarboxylicacid,4-(2-bromoethyl)-,1,2-dimethylethylester | | CAS: | 77095-51-3 | | MF: | C9H6O3 | | MW: | 162.14 | | EINECS: | | | Product Categories: | 77095-51-3 | | Mol File: | 77095-51-3.mol |  |
| | benzofuran-6-carboxylic acid Chemical Properties |
| Melting point | >182°C (dec.) | | Boiling point | 325.6±15.0 °C(Predicted) | | density | 1.363 | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.02±0.30(Predicted) | | color | Dark Yellow to Very Dark Yellow | | InChI | InChI=1S/C9H6O3/c10-9(11)7-2-1-6-3-4-12-8(6)5-7/h1-5H,(H,10,11) | | InChIKey | RVDHGRQELZPGCO-UHFFFAOYSA-N | | SMILES | O1C2=CC(C(O)=O)=CC=C2C=C1 | | CAS DataBase Reference | 77095-51-3 |
| | benzofuran-6-carboxylic acid Usage And Synthesis |
| Uses | Benzofuran-6-carboxylic Acid is a reagent in the development of potent LFA-1/ICAM antagonist SAR 118 as an opthalmic solution for treating dry eyes. Preparation of piperidinylpyrimidine derivatives as inhibitors of HIV-1 LTR activation.
It is also an important intermediate applied in organic synthesis. | | Uses | Benzofuran-6-carboxylic Acid is a reagent in the development of potent LFA-1/ICAM antagonist SAR 118 as an opthalmic solution for treating dry eyes. Preparation of piperidinylpyrimidine derivatives as inhibitors of HIV-1 LTR activation. |
| | benzofuran-6-carboxylic acid Preparation Products And Raw materials |
|