|
|
| | 2,4-Dichlorophenylhydrazine hydrochloride Basic information |
| Product Name: | 2,4-Dichlorophenylhydrazine hydrochloride | | Synonyms: | 1-(2,4-DICHLOROPHENYL)HYDRAZINE HYDROCHLORIDE;2,4-DICHLOROPHENYLHYDRAZINE HCL;2,4-DICHLOROPHENYLHYDRAZINE HYDROCHLORIDE;(2,4-dichlorophenyl)hydrazine monohydrochloride;2,4-Dichoropheynylhydrazine hydrochloride;4-Bromo-3-Aminoacetophdnone;Hydrazine, (2,4-dichlorophenyl)-, monohydrochloride;2,4-Dichlorophenylhydrazine hydrochloride 99% | | CAS: | 5446-18-4 | | MF: | C6H7Cl3N2 | | MW: | 213.49 | | EINECS: | 226-659-6 | | Product Categories: | Aromatic Hydrazides, Hydrazines, Hydrazones and Oximes;Phenylhydrazine;API intermediates;Hydrazines;Nitrogen Compounds;Organic Building Blocks;Amines and Anilines;Halides;bc0001 | | Mol File: | 5446-18-4.mol |  |
| | 2,4-Dichlorophenylhydrazine hydrochloride Chemical Properties |
| Melting point | 220-224 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | color | Off-white to light brown | | Water Solubility | soluble | | BRN | 3708828 | | InChI | InChI=1S/C6H6Cl2N2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3,10H,9H2;1H | | InChIKey | DDWYGJVFURAIJZ-UHFFFAOYSA-N | | SMILES | C1(NN)=CC=C(Cl)C=C1Cl.Cl | | CAS DataBase Reference | 5446-18-4(CAS DataBase Reference) |
| | 2,4-Dichlorophenylhydrazine hydrochloride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 2,4-Dichlorophenylhydrazine hydrochloride was used in the synthesis of pyrazole analogues of curcumin. |
| | 2,4-Dichlorophenylhydrazine hydrochloride Preparation Products And Raw materials |
|