|
|
| | 3,3-Tetramethyleneglutarimide Basic information |
| | 3,3-Tetramethyleneglutarimide Chemical Properties |
| Melting point | 153-155 °C | | Boiling point | 295.79°C (rough estimate) | | density | 1.1222 (rough estimate) | | refractive index | 1.4760 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | powder to crystal | | pka | 11.71±0.20(Predicted) | | color | White to Almost white | | BRN | 383702 | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C9H13NO2/c11-7-5-9(3-1-2-4-9)6-8(12)10-7/h1-6H2,(H,10,11,12) | | InChIKey | YRTHJMQKDCXPAY-UHFFFAOYSA-N | | SMILES | C1C2(CC(=O)NC(=O)C2)CCC1 | | CAS DataBase Reference | 1075-89-4(CAS DataBase Reference) | | NIST Chemistry Reference | 1,1-Cyclopentanediacetimide(1075-89-4) |
| Hazard Codes | T+ | | Risk Statements | 28 | | Safety Statements | 45-36/37/39 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29251995 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Chronic 2 |
| | 3,3-Tetramethyleneglutarimide Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | Buspirone intermediate. |
| | 3,3-Tetramethyleneglutarimide Preparation Products And Raw materials |
|