|
|
| | 2-Chloromethyl-3-Methyl-4-Methoxypyridine Basic information |
| Product Name: | 2-Chloromethyl-3-Methyl-4-Methoxypyridine | | Synonyms: | (2-ChloroMethyl-4-chloro- 3-Methylpyridine hydrochloride;2-CHLOROMETHYL-4-METHOXY-3-METHYLPYRIDINE HYDROCHL;2-chloromethyl-3-methyl-4-methoxypyridine;Rabeprazole Mercapto Impurity 1;Pyridine, 2-(chloromethyl)-4-methoxy-3-methyl;Pyridine, 2-(chloromethyl)-4-methoxy-3-methyl- (9CI);2-Chloromethyl-4-methoxy-3-methyl-pyridine;Ilaprazole Intermediate 1 | | CAS: | 124473-12-7 | | MF: | C8H10ClNO | | MW: | 171.62 | | EINECS: | 1806241-263-5 | | Product Categories: | HALOMETYL;Aromatics;Heterocycles;Intermediates | | Mol File: | 124473-12-7.mol |  |
| | 2-Chloromethyl-3-Methyl-4-Methoxypyridine Chemical Properties |
| Melting point | 145-149°C (dec.) | | Boiling point | 257.5±35.0 °C(Predicted) | | density | 1.139±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform, Methanol | | form | Solid | | pka | 5.29±0.30(Predicted) | | color | White | | InChI | InChI=1S/C8H10ClNO/c1-6-7(5-9)10-4-3-8(6)11-2/h3-4H,5H2,1-2H3 | | InChIKey | UIRCDHHEYPUZGA-UHFFFAOYSA-N | | SMILES | C1(CCl)=NC=CC(OC)=C1C |
| | 2-Chloromethyl-3-Methyl-4-Methoxypyridine Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 2-Chloromethyl-4-methoxy-3-methylpyridine is a pyridine derivative used in the preparation of anti-ulcerative agents and other pharmaceutical compounds. | | Uses | 2-CHLOROMETHYL-4-METHOXY-3-METHYLPYRIDINE HYDROCHLORIDE is used in the preparation of anti-ulcerative agents and other pharmaceutical compounds. |
| | 2-Chloromethyl-3-Methyl-4-Methoxypyridine Preparation Products And Raw materials |
|