|
|
| | 4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile Basic information |
| | 4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile Chemical Properties |
| Boiling point | 537.2±50.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.97±0.29(Predicted) | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C20H23FN2O2/c1-23(2)11-3-10-20(25,17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24/h4-9,12,24-25H,3,10-11,14H2,1-2H3 | | InChIKey | GNULRNVWXYXBQY-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(C(C2=CC=C(F)C=C2)(O)CCCN(C)C)C(CO)=C1 |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Skin Sens. 1A |
| | 4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile Usage And Synthesis |
| Uses | Escitalopram Open Ring is intended for use in analytical testing to detect, identify, and measure pharmaceutical impurities. |
| | 4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile Preparation Products And Raw materials |
|