|
|
| | 2-Fluoro-4-methylphenylboronic acid Basic information |
| | 2-Fluoro-4-methylphenylboronic acid Chemical Properties |
| Melting point | 228-233 °C(lit.) | | Boiling point | 277.8±50.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8+-.0.58(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C7H8BFO2/c1-5-2-3-6(8(10)11)7(9)4-5/h2-4,10-11H,1H3 | | InChIKey | LIXXGOMAGHXIMP-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C)C=C1F)(O)O | | CAS DataBase Reference | 170981-26-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-27-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 13 - Non Combustible Solids |
| | 2-Fluoro-4-methylphenylboronic acid Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Powder | | Uses | Reactant for:• ;Water-accelerated Pd-Catalyzed Suzuki-Miyaura coupling1 | | Uses | suzuki reaction | | Uses | 2-Fluoro-4-methylphenylboronic Acid (cas# 170981-26-7) is a compound useful in organic synthesis. |
| | 2-Fluoro-4-methylphenylboronic acid Preparation Products And Raw materials |
|