| Company Name: |
Shanghai Hansi Chemical Industry Co., Ltd. Gold
|
| Tel: |
17717618050 |
| Email: |
zllg@gh-reagent.com |
| Products Intro: |
Product Name:N-(3-Chlorobenzyl)ethanamine hydrochloride
CAS:90389-47-2
Purity:97% Package:5g Remarks:BJS0532273
|
Benzenemethanamine, 3-chloro-N-ethyl- manufacturers
|
| | Benzenemethanamine, 3-chloro-N-ethyl- Basic information |
| Product Name: | Benzenemethanamine, 3-chloro-N-ethyl- | | Synonyms: | Benzenemethanamine, 3-chloro-N-ethyl-;N-ETHYL-M-CHLOROBENZYLAMINE hydrochloride;N-(3-Chlorobenzyl)ethanamine hydrochloride;3-Chloro-N-ethylbenzylamine Hydrochloride;N-[(3-Chlorophenyl)methyl]ethanamine;N-ETHYL-M-CHLOROBENZYLAMINE HCL;Benzenemethanamine,3-chloro-N-ethyl-, hydrochloride (1:1) | | CAS: | 90389-47-2 | | MF: | C9H13Cl2N | | MW: | 206.11 | | EINECS: | | | Product Categories: | | | Mol File: | 90389-47-2.mol |  |
| | Benzenemethanamine, 3-chloro-N-ethyl- Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H12ClN.ClH/c1-2-11-7-8-4-3-5-9(10)6-8;/h3-6,11H,2,7H2,1H3;1H | | InChIKey | CLFVDOQPXQXDKK-UHFFFAOYSA-N | | SMILES | C(C1C=CC=C(Cl)C=1)NCC.Cl |
| | Benzenemethanamine, 3-chloro-N-ethyl- Usage And Synthesis |
| | Benzenemethanamine, 3-chloro-N-ethyl- Preparation Products And Raw materials |
|