2-PHENYLETHYL METHACRYLATE manufacturers
- 2-PHENYLETHYL METHACRYLATE
-
- $15.00 / 1KG
-
2021-07-13
- CAS:3683-12-3
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 2-PHENYLETHYL METHACRYLATE Basic information |
| Product Name: | 2-PHENYLETHYL METHACRYLATE | | Synonyms: | B-PHENYLETHYL METHACRYLATE;PHENYLETHYL METHACRYLATE;PHENETHYL METHACRYLATE;phenylethyl2-methyl-2-propenoate;METHACRYLICACID,PHENYLETHYLESTER;Phenethylmethacrylat;2-Methylpropenoic acid 2-phenylethyl ester;2-methylacrylic acid 2-phenylethyl ester | | CAS: | 3683-12-3 | | MF: | C12H14O2 | | MW: | 190.24 | | EINECS: | 222-969-0 | | Product Categories: | monomer | | Mol File: | 3683-12-3.mol |  |
| | 2-PHENYLETHYL METHACRYLATE Chemical Properties |
| Melting point | 119~120℃/11mm | | Boiling point | 119-120°C 11mm | | density | 0,976 g/cm3 | | refractive index | 1.4970 (estimate) | | Fp | 158℃ | | form | clear liquid | | color | Colorless to Light yellow | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C12H14O2/c1-10(2)12(13)14-9-8-11-6-4-3-5-7-11/h3-7H,1,8-9H2,2H3 | | InChIKey | ILZXXGLGJZQLTR-UHFFFAOYSA-N | | SMILES | C(OCCC1=CC=CC=C1)(=O)C(C)=C | | LogP | 3.032 (est) | | CAS DataBase Reference | 3683-12-3 | | EPA Substance Registry System | 2-Phenylethyl methacrylate (3683-12-3) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | TSCA | TSCA listed | | HS Code | 2916.14.2050 | | Toxicity | rabbit,LDLo,skin,5gm/kg (5000mg/kg),Food and Chemical Toxicology. Vol. 30, Pg. 105S, 1992. |
| | 2-PHENYLETHYL METHACRYLATE Usage And Synthesis |
| Uses | 2-Phenylethyl methacrylate finds use in perfume compositions, including soap perfumeswhere it may
lend warmth and pleasant “dried-leaf” notes
to a Rose or an Oriental type fragrance. It
blends well with the Methylionones, Cedarwood
products, Jasmin materials, Sandalwood
notes, etc. and it can be used in relatively
large amounts. | | Synthesis | 2-Phenylethyl methacrylate is prepared by azeotropic esterification of Phenylethylalcohol
with 2-Methylpropenoic acid. |
| | 2-PHENYLETHYL METHACRYLATE Preparation Products And Raw materials |
|