(+)-1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENE-D-THREITOL manufacturers
|
| | (+)-1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENE-D-THREITOL Basic information |
| Product Name: | (+)-1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENE-D-THREITOL | | Synonyms: | (4R 5R)-(+)-1 4-DI-O-TOSYL-2 3-O-ISOPROPYLIDENE-D-THREITOL;(4R,5R)-(+)-2,2-DIMETHYL-4,5-BIS(TOSYLOXYMETHYL)-1,3-DIOXIDE;(4R,5R)-(+)-2,3-O-ISOPROPYLIDENE-1,4-DI-O-TOSYL-D-THREITOL;(4R,5R)-(+)-4,5-BIS(TOSYLOXYMETHYL)-2,2-DIMETHYL-1,3-DIOXOLANE;(4R,5R)-4,5-BIS(TOSYLOXYMETHYL)-2,2-DIMETHYL-1,3-DIOXOLANE;(4R,5R)-(-)-O-ISOPROPYLIDENE-2,3-DIHYDROXY-1,4-BIS(P-TOSYL)BUTANE;(4S,5S)-(+)-O-ISOPROPYLIDENE-2,3-DIHYDROXY-1,4-BIS(P-TOSYL)BUTANE;(+)-2,3-O-ISOPROPYLIDENE-D-THREITOL 1,4-DITOSYLATE | | CAS: | 51064-65-4 | | MF: | C21H26O8S2 | | MW: | 470.56 | | EINECS: | 256-943-5 | | Product Categories: | chiral;Biochemistry;Dioxanes & Dioxolanes;Dioxolanes;O-Substituted Sugars;Sugar Alcohols;Sugars;organic compound | | Mol File: | 51064-65-4.mol |  |
| | (+)-1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENE-D-THREITOL Chemical Properties |
| Melting point | 90-92 °C | | Boiling point | 542.03°C (rough estimate) | | density | 1.3082 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | 2-8°C | | form | Powder | | color | white | | Optical Rotation | [α]20/D +12.1°, c = 8.8 in chloroform | | BRN | 99611 | | Stability: | store cold | | InChI | InChI=1/C21H26O8S2/c1-15-5-9-17(10-6-15)30(22,23)26-13-19-20(29-21(3,4)28-19)14-27-31(24,25)18-11-7-16(2)8-12-18/h5-12,19-20H,13-14H2,1-4H3/t19-,20-/s3 | | InChIKey | KPFDKWNWYAXRNJ-XEBFJNFFNA-N | | SMILES | [C@H]1(COS(=O)(=O)C2C=CC(C)=CC=2)OC(C)(C)O[C@@H]1COS(=O)(=O)C1C=CC(C)=CC=1 |&1:0,18,r| | | CAS DataBase Reference | 51064-65-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29329900 |
| | (+)-1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENE-D-THREITOL Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde |
| | (+)-1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENE-D-THREITOL Preparation Products And Raw materials |
|