| Company Name: |
Shanghai URChem Limited Gold |
| Tel: |
+86-021-50890968,021-50891159 +86-18601776121 |
| Email: |
danny@urchem.com |
| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | 1H-Indole-3-aceticacid,7-fluoro-(9CI) Basic information |
| | 1H-Indole-3-aceticacid,7-fluoro-(9CI) Chemical Properties |
| Boiling point | 417.9±30.0 °C(Predicted) | | density | 1.446±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.41±0.30(Predicted) | | InChI | InChI=1S/C10H8FNO2/c11-8-3-1-2-7-6(4-9(13)14)5-12-10(7)8/h1-3,5,12H,4H2,(H,13,14) | | InChIKey | MXEHCUNCVQVBQL-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2F)C(CC(O)=O)=C1 |
| | 1H-Indole-3-aceticacid,7-fluoro-(9CI) Usage And Synthesis |
| | 1H-Indole-3-aceticacid,7-fluoro-(9CI) Preparation Products And Raw materials |
|