|
|
| | 1H,1H,2H,2H-Perfluorohexyl iodide Basic information |
| Product Name: | 1H,1H,2H,2H-Perfluorohexyl iodide | | Synonyms: | 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodo-hexan;1,1,2,2-Tetrahydroperfluorohexyliodide;2-(NONAFLUOROBUTYL)ETHYL IODIDE;2-(PERFLUOROBUTYL)ETHYL IODIDE;1H,1H,2H,2H-PERFLUOROHEXYL IODIDE;1H,1H,2H,2H-NONAFLUOROHEXYL IODIDE;1H,1H,2H,2H-PERFLUORO-1-IODOHEXANE;1-IODO-1H,1H,2H,2H-NONAFLUOROHEXANE | | CAS: | 2043-55-2 | | MF: | C6H4F9I | | MW: | 373.99 | | EINECS: | 218-055-6 | | Product Categories: | Fluorous Chemistry;Fluorous Compounds;Synthetic Organic Chemistry | | Mol File: | 2043-55-2.mol |  |
| | 1H,1H,2H,2H-Perfluorohexyl iodide Chemical Properties |
| Melting point | -25°C | | Boiling point | 138 °C | | density | 1.94 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.370 | | Fp | 138-140°C | | storage temp. | 2-8°C | | solubility | Chloroform (Soluble), Methanol (Slightly) | | form | clear liquid | | color | Colorless to Light yellow to Light red | | Specific Gravity | 1.940 | | Sensitive | Light Sensitive | | BRN | 1870862 | | InChI | 1S/C6H4F9I/c7-3(8,1-2-16)4(9,10)5(11,12)6(13,14)15/h1-2H2 | | InChIKey | CXHFIVFPHDGZIS-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI | | CAS DataBase Reference | 2043-55-2(CAS DataBase Reference) | | EPA Substance Registry System | Hexane, 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodo- (2043-55-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 8 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29037800 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1H,1H,2H,2H-Perfluorohexyl iodide Usage And Synthesis |
| Description | 1H,1H,2H,2H-Perfluorohexyl iodide is a polyfluorinated iodine alkane (PFI). This compound consists of an even-numbered hydrophobic alkyl chain (typically C4–C12), which is wholly or partially fluorinated and includes an iodine atom at one or both ends. PFIs are reaction products synthesized from the telomerization process by iodine pentafluoride reacting with unsaturated taxogen molecules such as tetrafluoroethylene and ethylene. PFIs are used as critical industrial intermediates for producing various PFCs, such as fluorotelomer alcohols, olefins, and acrylate monomers[1]. | | Chemical Properties | Red liquid | | Uses | 1H,1H,2H,2H-Perfluorohexyl iodide has been used for the study for fluorinated phosphonium ionic liquids as a reagent, and in general is used as a reactant in organic reactions. | | References | [1] Ruan, Ting , et al. "Trace determination of airborne polyfluorinated iodine alkanes using multisorbent thermal desorption/gas chromatography/high resolution mass spectrometry." Journal of Chromatography A 1217.26(2010):4439-4447. |
| | 1H,1H,2H,2H-Perfluorohexyl iodide Preparation Products And Raw materials |
|