- 4-Di-2-ASP
-
- $39.00 / 1mg
-
2026-01-05
- CAS:105802-46-8
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | 4-DI-2-ASP Basic information |
| | 4-DI-2-ASP Chemical Properties |
| Melting point | 214-216 °C(lit.) | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | DMF: soluble | | form | Solid | | color | Red solid | | λmax | 488 nm (MeOH); 484.7 nm
(DMSO); 471 nm (H2O) | | BRN | 6101936 | | Biological Applications | Assessing nerveultrastructure; characterizing Merkel cells andmechanosensory axons; diagnosing of Hirschsprung’sdisease; identifying neuroepithelial bodies (NEBs);investigating stability and release properties ofbiodegradable polylactic acid (PLA) particles;measuring blood cells (erythrocytes, reticulocytes, bloodplatelets);visualizing nerve terminals and myelinatedfibers | | Major Application | Bentonite clay;characterizing supramolecular materials; visualizingmesopores and defects in porous molecular sieves;nonlinear optical devices/materials; photographicmaterials/systems;photoresists | | InChI | 1S/C18H23N2.HI/c1-4-20(5-2)18-10-8-16(9-11-18)6-7-17-12-14-19(3)15-13-17;/h6-15H,4-5H2,1-3H3;1H/q+1;/p-1 | | InChIKey | WIPKWLIHFGTFQV-UHFFFAOYSA-M | | SMILES | [I-].CCN(CC)c1ccc(\C=C\c2cc[n+](C)cc2)cc1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-DI-2-ASP Usage And Synthesis |
| Uses | Some cationic mitochondrial dyes such as 4-Di-1-ASP and 4-Di-2-ASP stain presynaptic nerve terminals independent of neuronal activity. | | Uses | Reactant or reagent involved in:• ;Two-photon absorption of organic / polyoxometalate hybrid dyes1• ;Acting as an acceptor for the 1D light-harvesting antenna2• ;Functional live cell fluorescence imaging for pulmonary neuroepithelial body microenvironments3• ;Studies of solvatochromism and dipole moments of monochromophoric styrylpyridinium dyes4 | | Uses | Fluorescent cationic styryl probe for mitochondrial staining | | Definition | ChEBI: An organic iodide salt consisting of pyridinium iodide having a methyl substituent at the 1-position and a 4-diethylaminostyryl substituent at the 4-position. |
| | 4-DI-2-ASP Preparation Products And Raw materials |
|