- HOMOPIPERONYLAMINE
-
- $1.10 / 1g
-
2025-11-18
- CAS:1484-85-1
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
- HOMOPIPERONYLAMINE
-
- $50.00 / 1kg
-
2025-06-20
- CAS:1484-85-1
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10000
|
| | Homopiperonylamine Basic information |
| | Homopiperonylamine Chemical Properties |
| Melting point | 114 °C | | Boiling point | 146-148°C/10 mm | | density | 1.2250 | | refractive index | 1.5620 (estimate) | | RTECS | SH9670000 | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform, Methanol | | form | Liquid | | pka | 9.90±0.10(Predicted) | | color | Colorless to pale yellow | | Sensitive | Air Sensitive | | InChI | InChI=1S/C9H11NO2/c10-4-3-7-1-2-8-9(5-7)12-6-11-8/h1-2,5H,3-4,6,10H2 | | InChIKey | RRIRDPSOCUCGBV-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(CCN)C=C2OC1 | | CAS DataBase Reference | 1484-85-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39-24/25 | | RIDADR | UN2735 | | WGK Germany | WGK 3 | | HazardClass | 8 | | HS Code | 29213000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | Homopiperonylamine Usage And Synthesis |
| Chemical Properties | Colourless Liquid | | Uses | An intermediate in the synthesis of pharmaceutical actives, intermediates and other fine chemicals | | Uses | 3,4-(Methylenedioxyphenyl)ethylamine is a metabolite of Dopamine analogs. |
| | Homopiperonylamine Preparation Products And Raw materials |
|