|
|
| | Potassium dimethyldithiocarbamate Basic information |
| | Potassium dimethyldithiocarbamate Chemical Properties |
| Melting point | <0°C | | Boiling point | 100°C | | density | 1.23-1.51 at 20℃ | | vapor pressure | 0-0Pa at 20-25℃ | | solubility | Methanol (Slightly), Water (Slightly) | | form | liquid | | Stability: | Stable. Incompatible with strong acids, strong oxidizing agents. | | InChI | InChI=1S/C3H7NS2.K/c1-4(2)3(5)6;/h1-2H3,(H,5,6);/q;+1/p-1 | | InChIKey | TVPFLPJBESCUKI-UHFFFAOYSA-M | | SMILES | [K+].C(=S)([S-])N(C)C | | LogP | -3.2--2.28 at pH5-9 | | Dissociation constant | 4.21 | | CAS DataBase Reference | 128-03-0(CAS DataBase Reference) | | EPA Substance Registry System | Potassium dimethyldithiocarbamate (128-03-0) |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN3077 9/PG 3 | | RTECS | FA0850000 | | TSCA | TSCA listed | | HS Code | 2934208090 | | Hazardous Substances Data | 128-03-0(Hazardous Substances Data) | | Toxicity | mouse,LD50,intraperitoneal,350mg/kg (350mg/kg),Acta Pharmacologica et Toxicologica. Vol. 8, Pg. 329, 1952. |
| | Potassium dimethyldithiocarbamate Usage And Synthesis |
| Chemical Properties | clear light amber liquid | | Uses | Busan 85 is a useful intermediate that has been used in the synthetic preparation of sulfonamide carbonic anhydrase inhibitors as antitumor agents. | | General Description | A concentrated aqueous solution. A green liquid. | | Air & Water Reactions | Decomposes slowly to generate toxic hydrogen sulfide and dimethylamine. | | Reactivity Profile | Potassium dimethyldithiocarbamate solution decomposes slowly to give hydrogen sulfide and dimethylamine. Decomposition is accelerated by acidification. Can generate flammable gases with aldehydes, nitrides, and hydrides. Incompatible with acids, peroxides, and acid halides. |
| | Potassium dimethyldithiocarbamate Preparation Products And Raw materials |
|