|
|
| | 2-[3-(2H-Benzotriazol-2-yl)-4-hydroxyphenyl]ethyl methacrylate Basic information |
| | 2-[3-(2H-Benzotriazol-2-yl)-4-hydroxyphenyl]ethyl methacrylate Chemical Properties |
| Melting point | 96-98 °C(lit.) | | Boiling point | 537.6±60.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | pka | 7.82±0.45(Predicted) | | form | Powder | | color | White to Orange to Green | | Cosmetics Ingredients Functions | LIGHT STABILIZER | | InChI | InChI=1S/C18H17N3O3/c1-12(2)18(23)24-10-9-13-7-8-17(22)16(11-13)21-19-14-5-3-4-6-15(14)20-21/h3-8,11,22H,1,9-10H2,2H3 | | InChIKey | VCYCUECVHJJFIQ-UHFFFAOYSA-N | | SMILES | C(OCCC1=CC=C(O)C(N2N=C3C=CC=CC3=N2)=C1)(=O)C(C)=C | | CAS DataBase Reference | 96478-09-0 | | EPA Substance Registry System | 2-Propenoic acid, 2-methyl-, 2-[3-(2H-benzotriazol-2-yl)-4-hydroxyphenyl]ethyl ester (96478-09-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | - | | TSCA | TSCA listed | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 2-[3-(2H-Benzotriazol-2-yl)-4-hydroxyphenyl]ethyl methacrylate Usage And Synthesis |
| Uses | It finds use
- in intraocular lenses,
- as a UV absorber (UVAs)?
| | General Description | It is capable of absorbing ultraviolet radiation (UV) and dissipate the energy in the form of heat, in sub-picosecond time scale. For the benzotriazole class of UV absorbers, the mechanism of excited-state deactivation is due to an excited-state intramolecular proton transfer. |
| | 2-[3-(2H-Benzotriazol-2-yl)-4-hydroxyphenyl]ethyl methacrylate Preparation Products And Raw materials |
|