- Hibifolin
-
- $32.00
-
2026-07-15
- CAS:55366-56-8
- Purity: 98.92%
- Supply Ability: 10g
|
| | hibifolin Basic information |
| Product Name: | hibifolin | | Synonyms: | Gossypetin 8-O-beta-D-glucuronide;Gossypetin 8-0-beta-D-glucuronide;hibifolin;[2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-4H-1-benzopyran-8-yl]β-D-glucopyranosiduronic acid;Gossypetin-8-O-β-D-glucuronide, Hibifolin;β-D-Glucopyranosiduronic acid, 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-4H-1-benzopyran-8-yl;Hibifolin，Gossypetin-8-O-β-D-glucuronid;Gossypetin Impurity 2(Gossypetin 8-O-beta-D-glucuronide) | | CAS: | 55366-56-8 | | MF: | C21H18O14 | | MW: | 494.36 | | EINECS: | | | Product Categories: | | | Mol File: | 55366-56-8.mol |  |
| | hibifolin Chemical Properties |
| Boiling point | 940.7±65.0 °C(Predicted) | | density | 1.987±0.06 g/cm3(Predicted) | | storage temp. | 4°C, protect from light | | solubility | DMSO:100.0(Max Conc. mg/mL);202.28(Max Conc. mM) | | pka | 2.73±0.70(Predicted) | | form | powder | | color | Yellow | | InChIKey | KHVMAMXQPVHXTJ-ORYXKJSJSA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1C(=O)O)O)O)O)Oc2c3[o]c(c([c](c3c(cc2O)O)=O)O)c4cc(c(cc4)O)O | | CAS DataBase Reference | 55366-56-8 |
| WGK Germany | WGK 3 | | HS Code | 2938909090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | hibifolin Usage And Synthesis |
| Uses | Hibifolin EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. |
| | hibifolin Preparation Products And Raw materials |
|