| Company Name: |
Hubei YoungXin Pharmaceutical Tech Co.,Ltd.
|
| Tel: |
07143999001 18696290611 |
| Email: |
3003339751@yongstandards.com |
| Products Intro: |
Product Name:Methotrexate-d3
CAS:432545-63-6
Purity:99%HPLC Package:10mg/;50mg/;100mg/
|
- Methotrexate-d3
-
- $698.00 / 5mg
-
2026-01-04
- CAS:432545-63-6
- Min. Order:
- Purity:
- Supply Ability: 10g
- Methotrexate-d3
-
- $500.00 / 10mg
-
2023-05-27
- CAS:432545-63-6
- Min. Order: 10mg
- Purity: 96%
- Supply Ability: 100
|
| | METHOTREXATE-D3 Basic information |
| | METHOTREXATE-D3 Chemical Properties |
| Melting point | 210°C dec. | | Fp | 9℃ | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Orange to Dark Yellow | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChIKey | FBOZXECLQNJBKD-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])N(Cc1cnc2nc(N)nc(N)c2n1)c3ccc(cc3)C(=O)NC(CCC(O)=O)C(O)=O |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
Met. Corr. 1
STOT SE 1 |
| | METHOTREXATE-D3 Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | Methotrexate-d3 Triglutamate is the isotope labelled analog of Methotrexate Triglutamate (M260725); a metabolite of Methotrexate (M260675) which is a folic acid antagonist, antineoplastic, and antirheumatic. | | Uses | METHOTREXATE-D3 is a Folic acid antagonistand ,used as a antineoplastic and antirheumatic. |
| | METHOTREXATE-D3 Preparation Products And Raw materials |
|