| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,6-Dimethoxy-4-methylbenzoic acid Basic information |
| | 2,6-Dimethoxy-4-methylbenzoic acid Chemical Properties |
| Melting point | 178-179 °C | | Boiling point | 345.5±37.0 °C(Predicted) | | density | 1.180±0.06 g/cm3(Predicted) | | pka | 4.15±0.10(Predicted) | | form | powder | | InChI | 1S/C10H12O4/c1-6-4-7(13-2)9(10(11)12)8(5-6)14-3/h4-5H,1-3H3,(H,11,12) | | InChIKey | FXRKFUSFSMFKID-UHFFFAOYSA-N | | SMILES | COC1=CC(C)=CC(OC)=C1C(O)=O |
| Storage Class | 11 - Combustible Solids |
| | 2,6-Dimethoxy-4-methylbenzoic acid Usage And Synthesis |
| | 2,6-Dimethoxy-4-methylbenzoic acid Preparation Products And Raw materials |
|