|
|
| | 6 alpha-naloxol Basic information |
| Product Name: | 6 alpha-naloxol | | Synonyms: | 6α-Naloxol;6-Alpha Naloxol HCl;6 alpha-naloxol;6a-Naloxol;Morphinan-3,6,14-triol,4,5-epoxy-17-(2-propen-1-yl)-, (5a,6a)-;Alpha-Naloxol;Morphinan-3,6,14-triol, 4,5-epoxy-17-(2-propen-1-yl)-, (5α,6α)-;6α-Naloxol solution | | CAS: | 20410-95-1 | | MF: | C19H23NO4 | | MW: | 329.394 | | EINECS: | | | Product Categories: | Metabolite Reference Standard | | Mol File: | 20410-95-1.mol |  |
| | 6 alpha-naloxol Chemical Properties |
| Melting point | 200-201 °C | | Boiling point | 532.5±50.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 30 mg/mL; DMSO: 30 mg/mL; Ethanol: 10 mg/mL | | form | A crystalline solid | | pka | 9.39±0.60(Predicted) | | Major Application | forensics and toxicology | | InChI | 1S/C19H23NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h2-4,13-14,17,21-23H,1,5-10H2/t13-,14+,17-,18-,19+/m0/s1 | | InChIKey | HMWHERQFMBEHNG-AQQQZIQISA-N | | SMILES | OC1=C(O2)C([C@]([C@@H]2[C@@H](O)CC3)(CCN4CC=C)[C@]3(O)[C@H]4C5)=C5C=C1 |
| WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 3
Flam. Liq. 2
STOT SE 1 |
| | 6 alpha-naloxol Usage And Synthesis |
| Uses | A labelled metabolite of Naloxone (N285000). Naltrexone analog and Naloxone analog neutral opioid antagonists and use thereof in treating drug abuse and pain. | | Definition | ChEBI: 6-Alpha Naloxol is a member of phenanthrenes. |
| | 6 alpha-naloxol Preparation Products And Raw materials |
|