|
|
| | lignocaine N-oxide Basic information |
| | lignocaine N-oxide Chemical Properties |
| Melting point | 127-129°C | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.35±0.70(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C14H22N2O2/c1-5-16(18,6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17) | | InChIKey | YDVXPJXUHRROBA-UHFFFAOYSA-N | | SMILES | C(NC1=C(C)C=CC=C1C)(=O)C[N+](CC)(CC)[O-] |
| | lignocaine N-oxide Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A novel metabolite of Lidocaine (L397800). | | Definition | ChEBI: Lidocaine n-oxide is an organooxygen compound and an organonitrogen compound. It is functionally related to an alpha-amino acid. |
| | lignocaine N-oxide Preparation Products And Raw materials |
|