|
|
| | [1]Benzothieno[2,3-c]pyridine, 1,7-dichloro-8-methyl- Basic information |
| Product Name: | [1]Benzothieno[2,3-c]pyridine, 1,7-dichloro-8-methyl- | | Synonyms: | [1]Benzothieno[2,3-c]pyridine, 1,7-dichloro-8-methyl-;1,7-Dichloro-8-methyl[1]benzothieno[2,3-c]pyridine;1,7-Dichloro-8-methylbenzo[4,5]thieno[2,3-c]pyridine | | CAS: | 2925321-29-3 | | MF: | C12H7Cl2NS | | MW: | 268.16 | | EINECS: | | | Product Categories: | | | Mol File: | 2925321-29-3.mol | ![[1]Benzothieno[2,3-c]pyridine, 1,7-dichloro-8-methyl- Structure](CAS/20210305/GIF/2925321-29-3.gif) |
| | [1]Benzothieno[2,3-c]pyridine, 1,7-dichloro-8-methyl- Chemical Properties |
| Boiling point | 440.1±40.0 °C(Predicted) | | density | 1.485±0.06 g/cm3(Temp: 20 °C; Press: 760 Torr)(Predicted) | | pka | -0.83±0.40(Predicted) | | InChI | InChI=1S/C12H7Cl2NS/c1-6-9(13)3-2-7-8-4-5-15-12(14)11(8)16-10(6)7/h2-5H,1H3 | | InChIKey | JFYVPBKGLVIWFK-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC2C3=CC=C(Cl)C(C)=C3SC1=2 |
| | [1]Benzothieno[2,3-c]pyridine, 1,7-dichloro-8-methyl- Usage And Synthesis |
| | [1]Benzothieno[2,3-c]pyridine, 1,7-dichloro-8-methyl- Preparation Products And Raw materials |
|