| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-mercaptobenzenesulfonic acid Basic information |
| Product Name: | 4-mercaptobenzenesulfonic acid | | Synonyms: | 4-mercaptobenzenesulfonic acid;Benzenesulfonic acid,4-mercapto-;4-sulfanylbenzene-1-sulfonic acid;Nsc127168;4-Mercaptobenzenesulphonicacid;p-Mercaptobenzenesulfonic acid;4-sulfanylbenzenesulfonic acid | | CAS: | 7134-41-0 | | MF: | C6H6O3S2 | | MW: | 190.24 | | EINECS: | | | Product Categories: | | | Mol File: | 7134-41-0.mol |  |
| | 4-mercaptobenzenesulfonic acid Chemical Properties |
| Melting point | 251-253℃ | | density | 1.524±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | -0.75±0.50(Predicted) | | Appearance | white solid | | InChI | InChI=1S/C6H6O3S2/c7-11(8,9)6-3-1-5(10)2-4-6/h1-4,10H,(H,7,8,9) | | InChIKey | ULBNVDPBWRTOPN-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC=C(S)C=C1 |
| | 4-mercaptobenzenesulfonic acid Usage And Synthesis |
| | 4-mercaptobenzenesulfonic acid Preparation Products And Raw materials |
|