|
|
| | Puberulicacid Basic information |
| Product Name: | Puberulicacid | | Synonyms: | 3,4,6-Trihydroxy-5-oxo-1,3,6-cycloheptatriene-1-carboxylic acid;Puberulic acid Ⅱ;1,3,6-Cycloheptatriene-1-carboxylic acid, 3,4,6-trihydroxy-5-oxo-;Puberulic acid / Puberlic acid;Puberulic acid Standard Solution 100μg/mL;3,4,6-Trihydroxy-5-oxocyclohepta-1,3,6-triene-1-carboxylic acid;Puberulic acid in Methanol;Puberulicacid | | CAS: | 99-23-0 | | MF: | C8H6O6 | | MW: | 198.13 | | EINECS: | | | Product Categories: | | | Mol File: | 99-23-0.mol |  |
| | Puberulicacid Chemical Properties |
| Melting point | 316-318° | | Boiling point | 233.9±40.0 °C(Predicted) | | density | 2.069±0.06 g/cm3(Predicted) | | pka | 3.16±0.20(Predicted) | | InChI | InChI=1S/C8H6O6/c9-4-1-3(8(13)14)2-5(10)7(12)6(4)11/h1-2H,(H,13,14)(H3,9,10,11,12) | | InChIKey | RRDGXYZZWSIADF-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)C=C(O)C(=O)C(O)=C(O)C=1 |
| | Puberulicacid Usage And Synthesis |
| Uses | Puberulic acid Ⅰ possesses anti-malarial activity with an IC50 value of 0.050μM against Plasmodium falciparum K1 (chloroquine-resistant)[1]. | | References | [1] Sennari G, et al. Antimalarial troponoids, puberulic acid and viticolins; divergent synthesis and structure-activity relationship studies. Sci Rep. 2017 Aug 3;7(1):7259. DOI:10.1038/s41598-017-07718-3 |
| | Puberulicacid Preparation Products And Raw materials |
|