|
|
| | EPOXYBERGAMOTTIN Basic information |
| Product Name: | EPOXYBERGAMOTTIN | | Synonyms: | EPOXYBERGAMOTTIN;6',7'-Epoxybergamottin;4-[[(2E)-5-(3,3-dimethyl-2-oxiranyl)-3-methyl-2-penten-1-yl]oxy]-7H-Furo[3,2-g][1]benzopyran-7-one;5-(6',7'-Epoxy)geranyloxypsoralen;7H-Furo[3,2-g][1]benzopyran-7-one, 4-[[(2E)-5-(3,3-dimethyloxiranyl)-3-methyl-2-pentenyl]oxy]-;7H-Furo[3,2-g][1]benzopyran-7-one, 4-[[(2E)-5-(3,3-dimethyl-2-oxiranyl)-3-methyl-2-penten-1-yl]oxy]- | | CAS: | 206978-14-5 | | MF: | C21H22O5 | | MW: | 354.4 | | EINECS: | | | Product Categories: | | | Mol File: | 206978-14-5.mol |  |
| | EPOXYBERGAMOTTIN Chemical Properties |
| Melting point | 69-70 °C | | Boiling point | 517.8±50.0 °C(Predicted) | | density | 1.210 | | storage temp. | -20°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:1): 0.50 mg/ml; Ethanol: 10 mg/ml | | form | powder | | color | White to off-white | | BRN | 7827230 | | InChI | 1S/C21H22O5/c1-13(4-6-18-21(2,3)26-18)8-10-24-20-14-5-7-19(22)25-17(14)12-16-15(20)9-11-23-16/h5,7-9,11-12,18H,4,6,10H2,1-3H3/b13-8+ | | InChIKey | OOKSPQLCQUBEKU-MDWZMJQESA-N | | SMILES | O=C(O1)C=CC2=C1C=C(OC=C3)C3=C2OC/C=C(C)/CCC4C(C)(C)O4 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | EPOXYBERGAMOTTIN Usage And Synthesis |
| Uses | 6',7'-Epoxybergamottin is a metabolism of Penicillium digitatum. 6',7'-Epoxybergamottin can be used in study the cytochrome P450 3A4 inhibitory activity[1]. | | Definition | ChEBI: Epoxybergamottin is a member of psoralens. | | References | [1] Myung K, et al. Biotransformations of 6',7'-dihydroxybergamottin and 6',7'-epoxybergamottin by the citrus-pathogenic fungi diminish cytochrome P450 3A4 inhibitory activity. Bioorg Med Chem Lett. 2012 Mar 15;22(6):2279-82. DOI:10.1016/j.bmcl.2012.01.081 |
| | EPOXYBERGAMOTTIN Preparation Products And Raw materials |
|