|
|
| | N1-Methyl-4-nitro-o-phenyldiamin Basic information |
| | N1-Methyl-4-nitro-o-phenyldiamin Chemical Properties |
| Melting point | 174-176° | | Boiling point | 366.8±32.0 °C(Predicted) | | density | 1.358±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.23±0.10(Predicted) | | color | Red Orange to Brown | | InChI | InChI=1S/C7H9N3O2/c1-9-7-3-2-5(10(11)12)4-6(7)8/h2-4,9H,8H2,1H3 | | InChIKey | MNIKERWISBANET-UHFFFAOYSA-N | | SMILES | C1(NC)=CC=C([N+]([O-])=O)C=C1N | | CAS DataBase Reference | 41939-61-1 |
| RIDADR | UN 2811 6.1/PG III | | HazardClass | IRRITANT | | PackingGroup | III | | HS Code | 2921511990 |
| | N1-Methyl-4-nitro-o-phenyldiamin Usage And Synthesis |
| Chemical Properties | Red Powder | | Uses | N’-Methyl-4-nitrophenylene-1,2-diamine (cas# 41939-61-1) is a compound useful in organic synthesis. | | Synthesis | Step 2: Pd/C (10%) was added to a solution of N-methyl-2,4-dinitroaniline (12.14 g, 60.9 mmol) in acetonitrile (35 mL) and triethylamine (36.4 mL). The reaction mixture was cooled to -15 °C, followed by dropwise addition of formic acid (11.1 mL) to a solution of acetonitrile (35 mL). The reaction mixture was refluxed for 3 hours and then thermally filtered. The filtrate was concentrated under reduced pressure to afford N1-methyl-4-nitrobenzene-1,2-diamine (Product 2) as a red liquid in >95% yield. | | References | [1] Organic and Biomolecular Chemistry, 2007, vol. 5, # 16, p. 2567 - 2571
[2] Patent: WO2010/85377, 2010, A2. Location in patent: Page/Page column 41
[3] Journal of the Indian Chemical Society, 1988, vol. 65, # 8, p. 567 - 570
[4] Patent: EP2769723, 2014, A1. Location in patent: Paragraph 0160-0161
[5] Patent: WO2014/128206, 2014, A1. Location in patent: Page/Page column 51 |
| | N1-Methyl-4-nitro-o-phenyldiamin Preparation Products And Raw materials |
|