|
|
| | Pyrazole-1,3-dimethyl-5-phenoxy-4-carboxaldehyde oxime Basic information |
| Product Name: | Pyrazole-1,3-dimethyl-5-phenoxy-4-carboxaldehyde oxime | | Synonyms: | Pyrazole-1,3-dimethyl-5-phenoxy-4-oxime;1,3-Dimethyl-5-phenoxy-1H-pyrazole-4-carboxaldehyde oxime;Pyrazole-1,3-dimethyl-5-phenoxy-4-carboxaldehyde oxime;1，3-dimethyl-5-phenoxy-oxim-1H-pyrazole-4-carboxaldehyde;1,3-DiMethyl-5-phenoxy-1H-pyrazole-4-carbaldehyde oxiMe;(E)-1,3-dimethyl-5-phenoxy-1H-pyrazole-4-carbaldehyde oxime;Pyrazole-1,3-dimethyl-5-phenoxy-4-carboxaldehyde oxime 110035-28-4;N-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylidene]hydroxylamine | | CAS: | 110035-28-4 | | MF: | C12H13N3O2 | | MW: | 231.25 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 110035-28-4.mol |  |
| | Pyrazole-1,3-dimethyl-5-phenoxy-4-carboxaldehyde oxime Chemical Properties |
| Melting point | 133-134 °C | | Boiling point | 359.4±42.0 °C(Predicted) | | density | 1.21 | | storage temp. | 2-8°C | | pka | 10.45±0.10(Predicted) | | InChI | InChI=1S/C12H13N3O2/c1-9-11(8-13-16)12(15(2)14-9)17-10-6-4-3-5-7-10/h3-8,16H,1-2H3 | | InChIKey | AKGVMZJNWXUJBJ-UHFFFAOYSA-N | | SMILES | N1(C)C(OC2=CC=CC=C2)=C(C=NO)C(C)=N1 | | CAS DataBase Reference | 110035-28-4 |
| | Pyrazole-1,3-dimethyl-5-phenoxy-4-carboxaldehyde oxime Usage And Synthesis |
| Chemical Properties | This product is white powdery solid, mp134～135℃, insoluble in water, soluble in methanol, ethanol and other organic solvents. | | Uses | Pyrazole-1,3-dimethyl-5-phenoxy-4-carboxaldehyde oxime is an intermediate for the synthesis of the acaricide fenpyroximate. | | Synthesis | 1,3-Dimethyl-5-phenoxy-4-formylpyrazole was dissolved in methanol, and hydroxylamine hydrochloride was added, and pyrazole-1,3-dimethyl-5-phenoxy-4-carboxaldehyde oxime was finally obtained by the reaction. |
| | Pyrazole-1,3-dimethyl-5-phenoxy-4-carboxaldehyde oxime Preparation Products And Raw materials |
|